About 3-phenylprop-2-enyl acetate
3-phenylprop-2-enyl acetate (PubChem CID 7660) has the molecular formula C11H12O2
and a molecular weight of 176.21 g/mol. Its IUPAC name is 3-phenylprop-2-enyl acetate.
Molecular Properties
| Compound Name | 3-phenylprop-2-enyl acetate |
| PubChem CID | 7660 |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | 3-phenylprop-2-enyl acetate |
| SMILES | CC(=O)OCC=Cc1ccccc1 |
| InChI | InChI=1S/C11H12O2/c1-10(12)13-9-5-8-11-6-3-2-4-7-11/h2-8H,9H2,1H3 |
| InChIKey | WJSDHUCWMSHDCR-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-phenylprop-2-enyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenylprop-2-enyl acetate?
The IUPAC name of 3-phenylprop-2-enyl acetate (CID 7660) is 3-phenylprop-2-enyl acetate.
What is the SMILES notation for 3-phenylprop-2-enyl acetate?
The canonical SMILES for 3-phenylprop-2-enyl acetate is CC(=O)OCC=Cc1ccccc1.
What is the InChIKey of 3-phenylprop-2-enyl acetate?
The InChIKey is WJSDHUCWMSHDCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O2/c1-10(12)13-9-5-8-11-6-3-2-4-7-11/h2-8H,9H2,1H3.
What are the key properties of 3-phenylprop-2-enyl acetate?
3-phenylprop-2-enyl acetate has a molecular weight of 176.21 g/mol, XLogP of 2.26, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylprop-2-enyl acetate is sourced from PubChem (CID 7660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).