About 11-methyldodec-9-enoic acid
11-methyldodec-9-enoic acid (PubChem CID 76621229) has the molecular formula C13H24O2
and a molecular weight of 212.33 g/mol. Its IUPAC name is 11-methyldodec-9-enoic acid.
Molecular Properties
| Compound Name | 11-methyldodec-9-enoic acid |
| PubChem CID | 76621229 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | 11-methyldodec-9-enoic acid |
| SMILES | CC(C)C=CCCCCCCCC(=O)O |
| InChI | InChI=1S/C13H24O2/c1-12(2)10-8-6-4-3-5-7-9-11-13(14)15/h8,10,12H,3-7,9,11H2,1-2H3,(H,14,15) |
| InChIKey | ZKSJOSDUOVKQHB-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 11-methyldodec-9-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-methyldodec-9-enoic acid?
The IUPAC name of 11-methyldodec-9-enoic acid (CID 76621229) is 11-methyldodec-9-enoic acid.
What is the SMILES notation for 11-methyldodec-9-enoic acid?
The canonical SMILES for 11-methyldodec-9-enoic acid is CC(C)C=CCCCCCCCC(=O)O.
What is the InChIKey of 11-methyldodec-9-enoic acid?
The InChIKey is ZKSJOSDUOVKQHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O2/c1-12(2)10-8-6-4-3-5-7-9-11-13(14)15/h8,10,12H,3-7,9,11H2,1-2H3,(H,14,15).
What are the key properties of 11-methyldodec-9-enoic acid?
11-methyldodec-9-enoic acid has a molecular weight of 212.33 g/mol, XLogP of 4.01, 9 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 11-methyldodec-9-enoic acid is sourced from PubChem (CID 76621229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).