C37H50O2 — CID 76625905
3-[5-methyl-2-(6,11,15,19,23-pentamethyltetracosa-2,4,6,8,10,12,14,16,18,22-decaen-2-yl)-2H-furan-5-yl]propanal (PubChem CID 76625905) has the molecular formula C37H50O2 and a molecular weight of 526.81 g/mol. Its IUPAC name is 3-[5-methyl-2-(6,11,15,19,23-pentamethyltetracosa-2,4,6,8,10,12,14,16,18,22-decaen-2-yl)-2H-furan-5-yl]propanal.
| Compound Name | 3-[5-methyl-2-(6,11,15,19,23-pentamethyltetracosa-2,4,6,8,10,12,14,16,18,22-decaen-2-yl)-2H-furan-5-yl]propanal |
|---|---|
| PubChem CID | 76625905 |
| Molecular Formula | C37H50O2 |
| Molecular Weight | 526.81 g/mol |
| Exact Mass | 526.38 |
| IUPAC Name | 3-[5-methyl-2-(6,11,15,19,23-pentamethyltetracosa-2,4,6,8,10,12,14,16,18,22-decaen-2-yl)-2H-furan-5-yl]propanal |
| SMILES | CC(C)=CCCC(C)=CC=CC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C1C=CC(C)(CCC=O)O1 |
| InChI | InChI=1S/C37H50O2/c1-30(2)16-11-19-33(5)21-13-23-34(6)22-12-20-31(3)17-9-10-18-32(4)24-14-25-35(7)36-26-28-37(8,39-36)27-15-29-38/h9-10,12-14,16-18,20-26,28-29,36H,11,15,19,27H2,1-8H3 |
| InChIKey | MZFFOBPWIAYVHE-UHFFFAOYSA-N |
| XLogP | 10.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.81 |
| LogP ≤ 5 | 10.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|