C40H54O2 — CID 76625912
2,6,10,14,19-pentamethyl-23-[5-methyl-5-(4-methylpent-3-enyl)-2H-furan-2-yl]tetracosa-2,6,8,10,12,14,16,18,20,22-decaen-4-one (PubChem CID 76625912) has the molecular formula C40H54O2 and a molecular weight of 566.87 g/mol. Its IUPAC name is 2,6,10,14,19-pentamethyl-23-[5-methyl-5-(4-methylpent-3-enyl)-2H-furan-2-yl]tetracosa-2,6,8,10,12,14,16,18,20,22-decaen-4-one.
| Compound Name | 2,6,10,14,19-pentamethyl-23-[5-methyl-5-(4-methylpent-3-enyl)-2H-furan-2-yl]tetracosa-2,6,8,10,12,14,16,18,20,22-decaen-4-one |
|---|---|
| PubChem CID | 76625912 |
| Molecular Formula | C40H54O2 |
| Molecular Weight | 566.87 g/mol |
| Exact Mass | 566.41 |
| IUPAC Name | 2,6,10,14,19-pentamethyl-23-[5-methyl-5-(4-methylpent-3-enyl)-2H-furan-2-yl]tetracosa-2,6,8,10,12,14,16,18,20,22-decaen-4-one |
| SMILES | CC(C)=CCCC1(C)C=CC(C(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC=C(C)CC(=O)C=C(C)C)O1 |
| InChI | InChI=1S/C40H54O2/c1-31(2)17-16-27-40(10)28-26-39(42-40)37(9)25-15-23-34(6)19-12-11-18-33(5)20-13-21-35(7)22-14-24-36(8)30-38(41)29-32(3)4/h11-15,17-26,28-29,39H,16,27,30H2,1-10H3 |
| InChIKey | KRUOMGHHIMFCOX-UHFFFAOYSA-N |
| XLogP | 11.33 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.87 |
| LogP ≤ 5 | 11.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|