C40H56O — CID 76625906
5-methyl-5-(4-methylpent-3-enyl)-2-(6,11,15,19,23-pentamethyltetracosa-2,4,6,8,10,12,14,16,18,22-decaen-2-yl)-2H-furan (PubChem CID 76625906) has the molecular formula C40H56O and a molecular weight of 552.89 g/mol. Its IUPAC name is 5-methyl-5-(4-methylpent-3-enyl)-2-(6,11,15,19,23-pentamethyltetracosa-2,4,6,8,10,12,14,16,18,22-decaen-2-yl)-2H-furan.
| Compound Name | 5-methyl-5-(4-methylpent-3-enyl)-2-(6,11,15,19,23-pentamethyltetracosa-2,4,6,8,10,12,14,16,18,22-decaen-2-yl)-2H-furan |
|---|---|
| PubChem CID | 76625906 |
| Molecular Formula | C40H56O |
| Molecular Weight | 552.89 g/mol |
| Exact Mass | 552.43 |
| IUPAC Name | 5-methyl-5-(4-methylpent-3-enyl)-2-(6,11,15,19,23-pentamethyltetracosa-2,4,6,8,10,12,14,16,18,22-decaen-2-yl)-2H-furan |
| SMILES | CC(C)=CCCC(C)=CC=CC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C1C=CC(C)(CCC=C(C)C)O1 |
| InChI | InChI=1S/C40H56O/c1-32(2)18-13-22-36(7)24-15-26-37(8)25-14-23-34(5)20-11-12-21-35(6)27-16-28-38(9)39-29-31-40(10,41-39)30-17-19-33(3)4/h11-12,14-16,18-21,23-29,31,39H,13,17,22,30H2,1-10H3 |
| InChIKey | AFCZCLRSUMCWPJ-UHFFFAOYSA-N |
| XLogP | 12.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.89 |
| LogP ≤ 5 | 12.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|