C15H16N6 — CID 76639738
5-[[1-(3-phenylprop-2-enyl)triazol-4-yl]methyl]-1H-imidazol-2-amine (PubChem CID 76639738) has the molecular formula C15H16N6 and a molecular weight of 280.34 g/mol. Its IUPAC name is 5-[[1-(3-phenylprop-2-enyl)triazol-4-yl]methyl]-1H-imidazol-2-amine.
| Compound Name | 5-[[1-(3-phenylprop-2-enyl)triazol-4-yl]methyl]-1H-imidazol-2-amine |
|---|---|
| PubChem CID | 76639738 |
| Molecular Formula | C15H16N6 |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 5-[[1-(3-phenylprop-2-enyl)triazol-4-yl]methyl]-1H-imidazol-2-amine |
| SMILES | Nc1ncc(Cc2cn(CC=Cc3ccccc3)nn2)[nH]1 |
| InChI | InChI=1S/C15H16N6/c16-15-17-10-13(18-15)9-14-11-21(20-19-14)8-4-7-12-5-2-1-3-6-12/h1-7,10-11H,8-9H2,(H3,16,17,18) |
| InChIKey | ZCIULHQDLWUQNJ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 85.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |