C15H15N7 — CID 58264394
5-[[1-(3H-indol-2-ylmethyl)triazol-4-yl]methyl]-1H-imidazol-2-amine (PubChem CID 58264394) has the molecular formula C15H15N7 and a molecular weight of 293.33 g/mol. Its IUPAC name is 5-[[1-(3H-indol-2-ylmethyl)triazol-4-yl]methyl]-1H-imidazol-2-amine.
| Compound Name | 5-[[1-(3H-indol-2-ylmethyl)triazol-4-yl]methyl]-1H-imidazol-2-amine |
|---|---|
| PubChem CID | 58264394 |
| Molecular Formula | C15H15N7 |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 5-[[1-(3H-indol-2-ylmethyl)triazol-4-yl]methyl]-1H-imidazol-2-amine |
| SMILES | Nc1ncc(Cc2cn(CC3=Nc4ccccc4C3)nn2)[nH]1 |
| InChI | InChI=1S/C15H15N7/c16-15-17-7-11(19-15)6-13-9-22(21-20-13)8-12-5-10-3-1-2-4-14(10)18-12/h1-4,7,9H,5-6,8H2,(H3,16,17,19) |
| InChIKey | MRXLMCOHKRUBBP-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 97.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |