C21H29N7 — CID 53359804
5-[5-[1-[(E)-3-[4-(aminomethyl)phenyl]-2-methylprop-2-enyl]triazol-4-yl]pentyl]-1H-imidazol-2-amine (PubChem CID 53359804) has the molecular formula C21H29N7 and a molecular weight of 379.51 g/mol. Its IUPAC name is 5-[5-[1-[(E)-3-[4-(aminomethyl)phenyl]-2-methylprop-2-enyl]triazol-4-yl]pentyl]-1H-imidazol-2-amine.
| Compound Name | 5-[5-[1-[(E)-3-[4-(aminomethyl)phenyl]-2-methylprop-2-enyl]triazol-4-yl]pentyl]-1H-imidazol-2-amine |
|---|---|
| PubChem CID | 53359804 |
| Molecular Formula | C21H29N7 |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.25 |
| IUPAC Name | 5-[5-[1-[(E)-3-[4-(aminomethyl)phenyl]-2-methylprop-2-enyl]triazol-4-yl]pentyl]-1H-imidazol-2-amine |
| SMILES | C/C(=C\c1ccc(CN)cc1)Cn1cc(CCCCCc2cnc(N)[nH]2)nn1 |
| InChI | InChI=1S/C21H29N7/c1-16(11-17-7-9-18(12-22)10-8-17)14-28-15-20(26-27-28)6-4-2-3-5-19-13-24-21(23)25-19/h7-11,13,15H,2-6,12,14,22H2,1H3,(H3,23,24,25)/b16-11+ |
| InChIKey | OFCNEXUHNAPBIJ-LFIBNONCSA-N |
| XLogP | 3.10 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|