C26H29FN6 — CID 56838715
4-(4-fluorophenyl)-5-[5-[1-[(E)-2-methyl-3-phenylprop-2-enyl]triazol-4-yl]pentyl]-1H-imidazol-2-amine (PubChem CID 56838715) has the molecular formula C26H29FN6 and a molecular weight of 444.56 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-5-[5-[1-[(E)-2-methyl-3-phenylprop-2-enyl]triazol-4-yl]pentyl]-1H-imidazol-2-amine.
| Compound Name | 4-(4-fluorophenyl)-5-[5-[1-[(E)-2-methyl-3-phenylprop-2-enyl]triazol-4-yl]pentyl]-1H-imidazol-2-amine |
|---|---|
| PubChem CID | 56838715 |
| Molecular Formula | C26H29FN6 |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | 4-(4-fluorophenyl)-5-[5-[1-[(E)-2-methyl-3-phenylprop-2-enyl]triazol-4-yl]pentyl]-1H-imidazol-2-amine |
| SMILES | C/C(=C\c1ccccc1)Cn1cc(CCCCCc2[nH]c(N)nc2-c2ccc(F)cc2)nn1 |
| InChI | InChI=1S/C26H29FN6/c1-19(16-20-8-4-2-5-9-20)17-33-18-23(31-32-33)10-6-3-7-11-24-25(30-26(28)29-24)21-12-14-22(27)15-13-21/h2,4-5,8-9,12-16,18H,3,6-7,10-11,17H2,1H3,(H3,28,29,30)/b19-16+ |
| InChIKey | GRWBRVWKHOOIGH-KNTRCKAVSA-N |
| XLogP | 5.45 |
| TPSA | 85.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|