C24H35ClN6O — CID 53359797
5-[5-[1-[(E)-3-(4-butoxyphenyl)-2-methylprop-2-enyl]triazol-4-yl]pentyl]-1H-imidazol-2-amine;hydrochloride (PubChem CID 53359797) has the molecular formula C24H35ClN6O and a molecular weight of 459.04 g/mol. Its IUPAC name is 5-[5-[1-[(E)-3-(4-butoxyphenyl)-2-methylprop-2-enyl]triazol-4-yl]pentyl]-1H-imidazol-2-amine;hydrochloride.
| Compound Name | 5-[5-[1-[(E)-3-(4-butoxyphenyl)-2-methylprop-2-enyl]triazol-4-yl]pentyl]-1H-imidazol-2-amine;hydrochloride |
|---|---|
| PubChem CID | 53359797 |
| Molecular Formula | C24H35ClN6O |
| Molecular Weight | 459.04 g/mol |
| Exact Mass | 458.26 |
| IUPAC Name | 5-[5-[1-[(E)-3-(4-butoxyphenyl)-2-methylprop-2-enyl]triazol-4-yl]pentyl]-1H-imidazol-2-amine;hydrochloride |
| SMILES | CCCCOc1ccc(/C=C(\C)Cn2cc(CCCCCc3cnc(N)[nH]3)nn2)cc1.Cl |
| InChI | InChI=1S/C24H34N6O.ClH/c1-3-4-14-31-23-12-10-20(11-13-23)15-19(2)17-30-18-22(28-29-30)9-7-5-6-8-21-16-26-24(25)27-21;/h10-13,15-16,18H,3-9,14,17H2,1-2H3,(H3,25,26,27);1H/b19-15+; |
| InChIKey | JBCWOSVCLLVKHC-QTCZRQAZSA-N |
| XLogP | 5.24 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.04 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|