C20H23Cl3N6O — CID 58264428
4-[4-[5-(2-amino-1H-imidazol-5-yl)pentyl]triazol-1-yl]-1-(2,4,6-trichlorophenyl)butan-1-one (PubChem CID 58264428) has the molecular formula C20H23Cl3N6O and a molecular weight of 469.80 g/mol. Its IUPAC name is 4-[4-[5-(2-amino-1H-imidazol-5-yl)pentyl]triazol-1-yl]-1-(2,4,6-trichlorophenyl)butan-1-one.
| Compound Name | 4-[4-[5-(2-amino-1H-imidazol-5-yl)pentyl]triazol-1-yl]-1-(2,4,6-trichlorophenyl)butan-1-one |
|---|---|
| PubChem CID | 58264428 |
| Molecular Formula | C20H23Cl3N6O |
| Molecular Weight | 469.80 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | 4-[4-[5-(2-amino-1H-imidazol-5-yl)pentyl]triazol-1-yl]-1-(2,4,6-trichlorophenyl)butan-1-one |
| SMILES | Nc1ncc(CCCCCc2cn(CCCC(=O)c3c(Cl)cc(Cl)cc3Cl)nn2)[nH]1 |
| InChI | InChI=1S/C20H23Cl3N6O/c21-13-9-16(22)19(17(23)10-13)18(30)7-4-8-29-12-15(27-28-29)6-3-1-2-5-14-11-25-20(24)26-14/h9-12H,1-8H2,(H3,24,25,26) |
| InChIKey | COEWRLIRTZDBIM-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 102.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.80 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|