C26H28F2N6O2 — CID 58264436
4-[4-[5-(2-amino-1H-imidazol-5-yl)pentyl]triazol-1-yl]-1-[4-(2,4-difluorophenyl)-2-hydroxyphenyl]butan-1-one (PubChem CID 58264436) has the molecular formula C26H28F2N6O2 and a molecular weight of 494.55 g/mol. Its IUPAC name is 4-[4-[5-(2-amino-1H-imidazol-5-yl)pentyl]triazol-1-yl]-1-[4-(2,4-difluorophenyl)-2-hydroxyphenyl]butan-1-one.
| Compound Name | 4-[4-[5-(2-amino-1H-imidazol-5-yl)pentyl]triazol-1-yl]-1-[4-(2,4-difluorophenyl)-2-hydroxyphenyl]butan-1-one |
|---|---|
| PubChem CID | 58264436 |
| Molecular Formula | C26H28F2N6O2 |
| Molecular Weight | 494.55 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | 4-[4-[5-(2-amino-1H-imidazol-5-yl)pentyl]triazol-1-yl]-1-[4-(2,4-difluorophenyl)-2-hydroxyphenyl]butan-1-one |
| SMILES | Nc1ncc(CCCCCc2cn(CCCC(=O)c3ccc(-c4ccc(F)cc4F)cc3O)nn2)[nH]1 |
| InChI | InChI=1S/C26H28F2N6O2/c27-18-9-11-21(23(28)14-18)17-8-10-22(25(36)13-17)24(35)7-4-12-34-16-20(32-33-34)6-3-1-2-5-19-15-30-26(29)31-19/h8-11,13-16,36H,1-7,12H2,(H3,29,30,31) |
| InChIKey | KEFOFSAXVWJDQA-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 122.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.55 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|