C22H22N5O4S+ — CID 76642885
3-[2-(1,3-benzodioxol-5-yl)ethyl]-8-(2,5-dimethoxyphenyl)sulfanyl-7H-purin-3-ium-6-amine (PubChem CID 76642885) has the molecular formula C22H22N5O4S+ and a molecular weight of 452.52 g/mol. Its IUPAC name is 3-[2-(1,3-benzodioxol-5-yl)ethyl]-8-(2,5-dimethoxyphenyl)sulfanyl-7H-purin-3-ium-6-amine.
| Compound Name | 3-[2-(1,3-benzodioxol-5-yl)ethyl]-8-(2,5-dimethoxyphenyl)sulfanyl-7H-purin-3-ium-6-amine |
|---|---|
| PubChem CID | 76642885 |
| Molecular Formula | C22H22N5O4S+ |
| Molecular Weight | 452.52 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | 3-[2-(1,3-benzodioxol-5-yl)ethyl]-8-(2,5-dimethoxyphenyl)sulfanyl-7H-purin-3-ium-6-amine |
| SMILES | COc1ccc(OC)c(Sc2nc3c([nH]2)c(N)nc[n+]3CCc2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C22H21N5O4S/c1-28-14-4-6-16(29-2)18(10-14)32-22-25-19-20(23)24-11-27(21(19)26-22)8-7-13-3-5-15-17(9-13)31-12-30-15/h3-6,9-11H,7-8,12H2,1-2H3,(H2,23,25,26)/p+1 |
| InChIKey | VOTCBOWBNQVDSK-UHFFFAOYSA-O |
| XLogP | 2.97 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.52 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|