C20H12BrF5N5O2S+ — CID 91497626
8-[(6-bromo-1,3-benzodioxol-5-yl)sulfanyl]-3-[2-(2,3,4,5,6-pentafluorophenyl)ethyl]-7H-purin-3-ium-6-amine (PubChem CID 91497626) has the molecular formula C20H12BrF5N5O2S+ and a molecular weight of 561.31 g/mol. Its IUPAC name is 8-[(6-bromo-1,3-benzodioxol-5-yl)sulfanyl]-3-[2-(2,3,4,5,6-pentafluorophenyl)ethyl]-7H-purin-3-ium-6-amine.
| Compound Name | 8-[(6-bromo-1,3-benzodioxol-5-yl)sulfanyl]-3-[2-(2,3,4,5,6-pentafluorophenyl)ethyl]-7H-purin-3-ium-6-amine |
|---|---|
| PubChem CID | 91497626 |
| Molecular Formula | C20H12BrF5N5O2S+ |
| Molecular Weight | 561.31 g/mol |
| Exact Mass | 559.98 |
| IUPAC Name | 8-[(6-bromo-1,3-benzodioxol-5-yl)sulfanyl]-3-[2-(2,3,4,5,6-pentafluorophenyl)ethyl]-7H-purin-3-ium-6-amine |
| SMILES | Nc1nc[n+](CCc2c(F)c(F)c(F)c(F)c2F)c2nc(Sc3cc4c(cc3Br)OCO4)[nH]c12 |
| InChI | InChI=1S/C20H11BrF5N5O2S/c21-8-3-9-10(33-6-32-9)4-11(8)34-20-29-17-18(27)28-5-31(19(17)30-20)2-1-7-12(22)14(24)16(26)15(25)13(7)23/h3-5H,1-2,6H2,(H2,27,29,30)/p+1 |
| InChIKey | ZKFINHCIONNGCM-UHFFFAOYSA-O |
| XLogP | 4.41 |
| TPSA | 89.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.31 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|