C20H15BrCl2N5O3S+ — CID 91075624
2-[6-amino-8-[(6-bromo-1,3-benzodioxol-5-yl)sulfanyl]-7H-purin-3-ium-3-yl]-1-(2,4-dichlorophenyl)ethanol (PubChem CID 91075624) has the molecular formula C20H15BrCl2N5O3S+ and a molecular weight of 556.25 g/mol. Its IUPAC name is 2-[6-amino-8-[(6-bromo-1,3-benzodioxol-5-yl)sulfanyl]-7H-purin-3-ium-3-yl]-1-(2,4-dichlorophenyl)ethanol.
| Compound Name | 2-[6-amino-8-[(6-bromo-1,3-benzodioxol-5-yl)sulfanyl]-7H-purin-3-ium-3-yl]-1-(2,4-dichlorophenyl)ethanol |
|---|---|
| PubChem CID | 91075624 |
| Molecular Formula | C20H15BrCl2N5O3S+ |
| Molecular Weight | 556.25 g/mol |
| Exact Mass | 553.95 |
| IUPAC Name | 2-[6-amino-8-[(6-bromo-1,3-benzodioxol-5-yl)sulfanyl]-7H-purin-3-ium-3-yl]-1-(2,4-dichlorophenyl)ethanol |
| SMILES | Nc1nc[n+](CC(O)c2ccc(Cl)cc2Cl)c2nc(Sc3cc4c(cc3Br)OCO4)[nH]c12 |
| InChI | InChI=1S/C20H14BrCl2N5O3S/c21-11-4-14-15(31-8-30-14)5-16(11)32-20-26-17-18(24)25-7-28(19(17)27-20)6-13(29)10-2-1-9(22)3-12(10)23/h1-5,7,13,29H,6,8H2,(H2,24,26,27)/p+1 |
| InChIKey | HPGGBNIVHNYWME-UHFFFAOYSA-O |
| XLogP | 4.51 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.25 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|