C20H22BrN6O4S+ — CID 90816268
4-[2-[6-amino-8-[(6-bromo-1,3-benzodioxol-5-yl)sulfanyl]-7H-purin-3-ium-3-yl]ethyl]piperidine-1-carboxylic acid (PubChem CID 90816268) has the molecular formula C20H22BrN6O4S+ and a molecular weight of 522.41 g/mol. Its IUPAC name is 4-[2-[6-amino-8-[(6-bromo-1,3-benzodioxol-5-yl)sulfanyl]-7H-purin-3-ium-3-yl]ethyl]piperidine-1-carboxylic acid.
| Compound Name | 4-[2-[6-amino-8-[(6-bromo-1,3-benzodioxol-5-yl)sulfanyl]-7H-purin-3-ium-3-yl]ethyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 90816268 |
| Molecular Formula | C20H22BrN6O4S+ |
| Molecular Weight | 522.41 g/mol |
| Exact Mass | 521.06 |
| IUPAC Name | 4-[2-[6-amino-8-[(6-bromo-1,3-benzodioxol-5-yl)sulfanyl]-7H-purin-3-ium-3-yl]ethyl]piperidine-1-carboxylic acid |
| SMILES | Nc1nc[n+](CCC2CCN(C(=O)O)CC2)c2nc(Sc3cc4c(cc3Br)OCO4)[nH]c12 |
| InChI | InChI=1S/C20H21BrN6O4S/c21-12-7-13-14(31-10-30-13)8-15(12)32-19-24-16-17(22)23-9-27(18(16)25-19)6-3-11-1-4-26(5-2-11)20(28)29/h7-9,11H,1-6,10H2,(H3,22,24,25,28,29)/p+1 |
| InChIKey | YNDUBMQPSQBGDA-UHFFFAOYSA-O |
| XLogP | 3.25 |
| TPSA | 130.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.41 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|