C21H26BrN6O3S+ — CID 59581183
4-[2-[6-amino-8-(2-bromo-4,5-dimethoxyphenyl)sulfanyl-7H-purin-9-ium-9-yl]ethyl]piperidine-1-carbaldehyde (PubChem CID 59581183) has the molecular formula C21H26BrN6O3S+ and a molecular weight of 522.45 g/mol. Its IUPAC name is 4-[2-[6-amino-8-(2-bromo-4,5-dimethoxyphenyl)sulfanyl-7H-purin-9-ium-9-yl]ethyl]piperidine-1-carbaldehyde.
| Compound Name | 4-[2-[6-amino-8-(2-bromo-4,5-dimethoxyphenyl)sulfanyl-7H-purin-9-ium-9-yl]ethyl]piperidine-1-carbaldehyde |
|---|---|
| PubChem CID | 59581183 |
| Molecular Formula | C21H26BrN6O3S+ |
| Molecular Weight | 522.45 g/mol |
| Exact Mass | 521.10 |
| IUPAC Name | 4-[2-[6-amino-8-(2-bromo-4,5-dimethoxyphenyl)sulfanyl-7H-purin-9-ium-9-yl]ethyl]piperidine-1-carbaldehyde |
| SMILES | COc1cc(Br)c(Sc2[nH]c3c(N)ncnc3[n+]2CCC2CCN(C=O)CC2)cc1OC |
| InChI | InChI=1S/C21H25BrN6O3S/c1-30-15-9-14(22)17(10-16(15)31-2)32-21-26-18-19(23)24-11-25-20(18)28(21)8-5-13-3-6-27(12-29)7-4-13/h9-13H,3-8H2,1-2H3,(H2,23,24,25)/p+1 |
| InChIKey | YWLMQFLSIPYVNT-UHFFFAOYSA-O |
| XLogP | 3.02 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.45 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|