C27H28BrN6O4S+ — CID 90722540
benzyl 3-[2-[6-amino-8-[(6-bromo-1,3-benzodioxol-5-yl)sulfanyl]-7H-purin-3-ium-3-yl]ethyl]piperidine-1-carboxylate (PubChem CID 90722540) has the molecular formula C27H28BrN6O4S+ and a molecular weight of 612.53 g/mol. Its IUPAC name is benzyl 3-[2-[6-amino-8-[(6-bromo-1,3-benzodioxol-5-yl)sulfanyl]-7H-purin-3-ium-3-yl]ethyl]piperidine-1-carboxylate.
| Compound Name | benzyl 3-[2-[6-amino-8-[(6-bromo-1,3-benzodioxol-5-yl)sulfanyl]-7H-purin-3-ium-3-yl]ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 90722540 |
| Molecular Formula | C27H28BrN6O4S+ |
| Molecular Weight | 612.53 g/mol |
| Exact Mass | 611.11 |
| IUPAC Name | benzyl 3-[2-[6-amino-8-[(6-bromo-1,3-benzodioxol-5-yl)sulfanyl]-7H-purin-3-ium-3-yl]ethyl]piperidine-1-carboxylate |
| SMILES | Nc1nc[n+](CCC2CCCN(C(=O)OCc3ccccc3)C2)c2nc(Sc3cc4c(cc3Br)OCO4)[nH]c12 |
| InChI | InChI=1S/C27H27BrN6O4S/c28-19-11-20-21(38-16-37-20)12-22(19)39-26-31-23-24(29)30-15-34(25(23)32-26)10-8-17-7-4-9-33(13-17)27(35)36-14-18-5-2-1-3-6-18/h1-3,5-6,11-12,15,17H,4,7-10,13-14,16H2,(H2,29,31,32)/p+1 |
| InChIKey | JFAPGCQPZBODIF-UHFFFAOYSA-O |
| XLogP | 4.91 |
| TPSA | 119.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.53 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|