C21H27N6O3S+ — CID 91206711
4-[2-[6-amino-8-(2,5-dimethoxyphenyl)sulfanyl-7H-purin-3-ium-3-yl]ethyl]piperidine-1-carbaldehyde (PubChem CID 91206711) has the molecular formula C21H27N6O3S+ and a molecular weight of 443.55 g/mol. Its IUPAC name is 4-[2-[6-amino-8-(2,5-dimethoxyphenyl)sulfanyl-7H-purin-3-ium-3-yl]ethyl]piperidine-1-carbaldehyde.
| Compound Name | 4-[2-[6-amino-8-(2,5-dimethoxyphenyl)sulfanyl-7H-purin-3-ium-3-yl]ethyl]piperidine-1-carbaldehyde |
|---|---|
| PubChem CID | 91206711 |
| Molecular Formula | C21H27N6O3S+ |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | 4-[2-[6-amino-8-(2,5-dimethoxyphenyl)sulfanyl-7H-purin-3-ium-3-yl]ethyl]piperidine-1-carbaldehyde |
| SMILES | COc1ccc(OC)c(Sc2nc3c([nH]2)c(N)nc[n+]3CCC2CCN(C=O)CC2)c1 |
| InChI | InChI=1S/C21H26N6O3S/c1-29-15-3-4-16(30-2)17(11-15)31-21-24-18-19(22)23-12-27(20(18)25-21)10-7-14-5-8-26(13-28)9-6-14/h3-4,11-14H,5-10H2,1-2H3,(H2,22,24,25)/p+1 |
| InChIKey | QBSDLJRXSPFTKN-UHFFFAOYSA-O |
| XLogP | 2.25 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|