C21H20Cl2N5O3S+ — CID 91121103
2-[6-amino-8-(2,5-dimethoxyphenyl)sulfanyl-7H-purin-3-ium-3-yl]-1-(2,4-dichlorophenyl)ethanol (PubChem CID 91121103) has the molecular formula C21H20Cl2N5O3S+ and a molecular weight of 493.40 g/mol. Its IUPAC name is 2-[6-amino-8-(2,5-dimethoxyphenyl)sulfanyl-7H-purin-3-ium-3-yl]-1-(2,4-dichlorophenyl)ethanol.
| Compound Name | 2-[6-amino-8-(2,5-dimethoxyphenyl)sulfanyl-7H-purin-3-ium-3-yl]-1-(2,4-dichlorophenyl)ethanol |
|---|---|
| PubChem CID | 91121103 |
| Molecular Formula | C21H20Cl2N5O3S+ |
| Molecular Weight | 493.40 g/mol |
| Exact Mass | 492.07 |
| IUPAC Name | 2-[6-amino-8-(2,5-dimethoxyphenyl)sulfanyl-7H-purin-3-ium-3-yl]-1-(2,4-dichlorophenyl)ethanol |
| SMILES | COc1ccc(OC)c(Sc2nc3c([nH]2)c(N)nc[n+]3CC(O)c2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C21H19Cl2N5O3S/c1-30-12-4-6-16(31-2)17(8-12)32-21-26-18-19(24)25-10-28(20(18)27-21)9-15(29)13-5-3-11(22)7-14(13)23/h3-8,10,15,29H,9H2,1-2H3,(H2,24,26,27)/p+1 |
| InChIKey | ARYFLGPBDBUHQX-UHFFFAOYSA-O |
| XLogP | 4.04 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.40 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|