C19H18Cl2N4O3S — CID 71028116
4-[5-(aminomethoxy)-2,4-dichlorophenyl]-6-(2,5-dimethoxyphenyl)sulfanylpyrimidin-2-amine (PubChem CID 71028116) has the molecular formula C19H18Cl2N4O3S and a molecular weight of 453.35 g/mol. Its IUPAC name is 4-[5-(aminomethoxy)-2,4-dichlorophenyl]-6-(2,5-dimethoxyphenyl)sulfanylpyrimidin-2-amine.
| Compound Name | 4-[5-(aminomethoxy)-2,4-dichlorophenyl]-6-(2,5-dimethoxyphenyl)sulfanylpyrimidin-2-amine |
|---|---|
| PubChem CID | 71028116 |
| Molecular Formula | C19H18Cl2N4O3S |
| Molecular Weight | 453.35 g/mol |
| Exact Mass | 452.05 |
| IUPAC Name | 4-[5-(aminomethoxy)-2,4-dichlorophenyl]-6-(2,5-dimethoxyphenyl)sulfanylpyrimidin-2-amine |
| SMILES | COc1ccc(OC)c(Sc2cc(-c3cc(OCN)c(Cl)cc3Cl)nc(N)n2)c1 |
| InChI | InChI=1S/C19H18Cl2N4O3S/c1-26-10-3-4-15(27-2)17(5-10)29-18-8-14(24-19(23)25-18)11-6-16(28-9-22)13(21)7-12(11)20/h3-8H,9,22H2,1-2H3,(H2,23,24,25) |
| InChIKey | HHCLOBUYNOQMMP-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 105.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.35 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|