C11H13N5OS — CID 80923485
4-hydrazinyl-6-(2-methoxyphenyl)sulfanylpyrimidin-2-amine (PubChem CID 80923485) has the molecular formula C11H13N5OS and a molecular weight of 263.33 g/mol. Its IUPAC name is 4-hydrazinyl-6-(2-methoxyphenyl)sulfanylpyrimidin-2-amine.
| Compound Name | 4-hydrazinyl-6-(2-methoxyphenyl)sulfanylpyrimidin-2-amine |
|---|---|
| PubChem CID | 80923485 |
| Molecular Formula | C11H13N5OS |
| Molecular Weight | 263.33 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | 4-hydrazinyl-6-(2-methoxyphenyl)sulfanylpyrimidin-2-amine |
| SMILES | COc1ccccc1Sc1cc(NN)nc(N)n1 |
| InChI | InChI=1S/C11H13N5OS/c1-17-7-4-2-3-5-8(7)18-10-6-9(16-13)14-11(12)15-10/h2-6H,13H2,1H3,(H3,12,14,15,16) |
| InChIKey | UCFBDJDPIXZLEP-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.33 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|