C25H35N6O4S+ — CID 91098489
tert-butyl 4-[2-[6-amino-8-(2,5-dimethoxyphenyl)sulfanyl-7H-purin-3-ium-3-yl]ethyl]piperidine-1-carboxylate (PubChem CID 91098489) has the molecular formula C25H35N6O4S+ and a molecular weight of 515.66 g/mol. Its IUPAC name is tert-butyl 4-[2-[6-amino-8-(2,5-dimethoxyphenyl)sulfanyl-7H-purin-3-ium-3-yl]ethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[6-amino-8-(2,5-dimethoxyphenyl)sulfanyl-7H-purin-3-ium-3-yl]ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 91098489 |
| Molecular Formula | C25H35N6O4S+ |
| Molecular Weight | 515.66 g/mol |
| Exact Mass | 515.24 |
| IUPAC Name | tert-butyl 4-[2-[6-amino-8-(2,5-dimethoxyphenyl)sulfanyl-7H-purin-3-ium-3-yl]ethyl]piperidine-1-carboxylate |
| SMILES | COc1ccc(OC)c(Sc2nc3c([nH]2)c(N)nc[n+]3CCC2CCN(C(=O)OC(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C25H34N6O4S/c1-25(2,3)35-24(32)30-11-8-16(9-12-30)10-13-31-15-27-21(26)20-22(31)29-23(28-20)36-19-14-17(33-4)6-7-18(19)34-5/h6-7,14-16H,8-13H2,1-5H3,(H2,26,28,29)/p+1 |
| InChIKey | PVBRTHXLBTVPMH-UHFFFAOYSA-O |
| XLogP | 4.03 |
| TPSA | 119.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.66 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|