C20H12BrF11N5O2S+ — CID 91449442
8-[(6-bromo-1,3-benzodioxol-5-yl)sulfanyl]-3-[2-(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)ethyl]-7H-purin-3-ium-6-amine (PubChem CID 91449442) has the molecular formula C20H12BrF11N5O2S+ and a molecular weight of 675.30 g/mol. Its IUPAC name is 8-[(6-bromo-1,3-benzodioxol-5-yl)sulfanyl]-3-[2-(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)ethyl]-7H-purin-3-ium-6-amine.
| Compound Name | 8-[(6-bromo-1,3-benzodioxol-5-yl)sulfanyl]-3-[2-(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)ethyl]-7H-purin-3-ium-6-amine |
|---|---|
| PubChem CID | 91449442 |
| Molecular Formula | C20H12BrF11N5O2S+ |
| Molecular Weight | 675.30 g/mol |
| Exact Mass | 673.97 |
| IUPAC Name | 8-[(6-bromo-1,3-benzodioxol-5-yl)sulfanyl]-3-[2-(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)ethyl]-7H-purin-3-ium-6-amine |
| SMILES | Nc1nc[n+](CCC2(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C2(F)F)c2nc(Sc3cc4c(cc3Br)OCO4)[nH]c12 |
| InChI | InChI=1S/C20H11BrF11N5O2S/c21-7-3-8-9(39-6-38-8)4-10(7)40-14-35-11-12(33)34-5-37(13(11)36-14)2-1-15(22)16(23,24)18(27,28)20(31,32)19(29,30)17(15,25)26/h3-5H,1-2,6H2,(H2,33,35,36)/p+1 |
| InChIKey | RMOWSTGRMPESHH-UHFFFAOYSA-O |
| XLogP | 5.76 |
| TPSA | 89.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.30 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|