C11H8F4N2O — CID 76655437
N-[1,1,1-trifluoro-3-(5-fluoro-1H-indol-3-yl)propan-2-ylidene]hydroxylamine (PubChem CID 76655437) has the molecular formula C11H8F4N2O and a molecular weight of 260.19 g/mol. Its IUPAC name is N-[1,1,1-trifluoro-3-(5-fluoro-1H-indol-3-yl)propan-2-ylidene]hydroxylamine.
| Compound Name | N-[1,1,1-trifluoro-3-(5-fluoro-1H-indol-3-yl)propan-2-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 76655437 |
| Molecular Formula | C11H8F4N2O |
| Molecular Weight | 260.19 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | N-[1,1,1-trifluoro-3-(5-fluoro-1H-indol-3-yl)propan-2-ylidene]hydroxylamine |
| SMILES | ON=C(Cc1c[nH]c2ccc(F)cc12)C(F)(F)F |
| InChI | InChI=1S/C11H8F4N2O/c12-7-1-2-9-8(4-7)6(5-16-9)3-10(17-18)11(13,14)15/h1-2,4-5,16,18H,3H2 |
| InChIKey | FLVZFVZDMIRVQH-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 48.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.19 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|