C18H22N2O5 — CID 7666481
ethyl (2S)-2-[3-(2,4-dimethoxyphenyl)-6-oxopyridazin-1-yl]butanoate (PubChem CID 7666481) has the molecular formula C18H22N2O5 and a molecular weight of 346.38 g/mol. Its IUPAC name is ethyl (2S)-2-[3-(2,4-dimethoxyphenyl)-6-oxopyridazin-1-yl]butanoate.
| Compound Name | ethyl (2S)-2-[3-(2,4-dimethoxyphenyl)-6-oxopyridazin-1-yl]butanoate |
|---|---|
| PubChem CID | 7666481 |
| Molecular Formula | C18H22N2O5 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | ethyl (2S)-2-[3-(2,4-dimethoxyphenyl)-6-oxopyridazin-1-yl]butanoate |
| SMILES | CCOC(=O)[C@H](CC)n1nc(-c2ccc(OC)cc2OC)ccc1=O |
| InChI | InChI=1S/C18H22N2O5/c1-5-15(18(22)25-6-2)20-17(21)10-9-14(19-20)13-8-7-12(23-3)11-16(13)24-4/h7-11,15H,5-6H2,1-4H3/t15-/m0/s1 |
| InChIKey | FNRFSTNUZKHCKB-HNNXBMFYSA-N |
| XLogP | 2.44 |
| TPSA | 79.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |