C18H22N2O3 — CID 7665828
ethyl (2S)-2-[3-(2,4-dimethylphenyl)-6-oxopyridazin-1-yl]butanoate (PubChem CID 7665828) has the molecular formula C18H22N2O3 and a molecular weight of 314.39 g/mol. Its IUPAC name is ethyl (2S)-2-[3-(2,4-dimethylphenyl)-6-oxopyridazin-1-yl]butanoate.
| Compound Name | ethyl (2S)-2-[3-(2,4-dimethylphenyl)-6-oxopyridazin-1-yl]butanoate |
|---|---|
| PubChem CID | 7665828 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | ethyl (2S)-2-[3-(2,4-dimethylphenyl)-6-oxopyridazin-1-yl]butanoate |
| SMILES | CCOC(=O)[C@H](CC)n1nc(-c2ccc(C)cc2C)ccc1=O |
| InChI | InChI=1S/C18H22N2O3/c1-5-16(18(22)23-6-2)20-17(21)10-9-15(19-20)14-8-7-12(3)11-13(14)4/h7-11,16H,5-6H2,1-4H3/t16-/m0/s1 |
| InChIKey | YHEKVMPHVCOJNA-INIZCTEOSA-N |
| XLogP | 3.04 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |