C25H23N6O2S+ — CID 76665790
2-methyl-3-[5-[2-(oxan-2-yl)-1H-1,2,4-triazol-2-ium-5-yl]-4-phenyl-1,3-thiazol-2-yl]imidazo[1,2-a]pyridine-6-carbaldehyde (PubChem CID 76665790) has the molecular formula C25H23N6O2S+ and a molecular weight of 471.57 g/mol. Its IUPAC name is 2-methyl-3-[5-[2-(oxan-2-yl)-1H-1,2,4-triazol-2-ium-5-yl]-4-phenyl-1,3-thiazol-2-yl]imidazo[1,2-a]pyridine-6-carbaldehyde.
| Compound Name | 2-methyl-3-[5-[2-(oxan-2-yl)-1H-1,2,4-triazol-2-ium-5-yl]-4-phenyl-1,3-thiazol-2-yl]imidazo[1,2-a]pyridine-6-carbaldehyde |
|---|---|
| PubChem CID | 76665790 |
| Molecular Formula | C25H23N6O2S+ |
| Molecular Weight | 471.57 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | 2-methyl-3-[5-[2-(oxan-2-yl)-1H-1,2,4-triazol-2-ium-5-yl]-4-phenyl-1,3-thiazol-2-yl]imidazo[1,2-a]pyridine-6-carbaldehyde |
| SMILES | Cc1nc2ccc(C=O)cn2c1-c1nc(-c2ccccc2)c(-c2nc[n+](C3CCCCO3)[nH]2)s1 |
| InChI | InChI=1S/C25H22N6O2S/c1-16-22(30-13-17(14-32)10-11-19(30)27-16)25-28-21(18-7-3-2-4-8-18)23(34-25)24-26-15-31(29-24)20-9-5-6-12-33-20/h2-4,7-8,10-11,13-15,20H,5-6,9,12H2,1H3/p+1 |
| InChIKey | HNEFFSAJTLFISI-UHFFFAOYSA-O |
| XLogP | 4.62 |
| TPSA | 89.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.57 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|