C17H21F3N2O2 — CID 76673398
tert-butyl N-[1-[6-(trifluoromethyl)-3-pyridinyl]hex-5-yn-2-yl]carbamate (PubChem CID 76673398) has the molecular formula C17H21F3N2O2 and a molecular weight of 342.36 g/mol. Its IUPAC name is tert-butyl N-[1-[6-(trifluoromethyl)-3-pyridinyl]hex-5-yn-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[6-(trifluoromethyl)-3-pyridinyl]hex-5-yn-2-yl]carbamate |
|---|---|
| PubChem CID | 76673398 |
| Molecular Formula | C17H21F3N2O2 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | tert-butyl N-[1-[6-(trifluoromethyl)-3-pyridinyl]hex-5-yn-2-yl]carbamate |
| SMILES | C#CCCC(Cc1ccc(C(F)(F)F)nc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H21F3N2O2/c1-5-6-7-13(22-15(23)24-16(2,3)4)10-12-8-9-14(21-11-12)17(18,19)20/h1,8-9,11,13H,6-7,10H2,2-4H3,(H,22,23) |
| InChIKey | XJHXVEPWENPRPX-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|