C19H18N2O4 — CID 76683951
2-benzyl-6-(3,4-dimethoxyphenoxy)pyridazin-3-one (PubChem CID 76683951) has the molecular formula C19H18N2O4 and a molecular weight of 338.36 g/mol. Its IUPAC name is 2-benzyl-6-(3,4-dimethoxyphenoxy)pyridazin-3-one.
| Compound Name | 2-benzyl-6-(3,4-dimethoxyphenoxy)pyridazin-3-one |
|---|---|
| PubChem CID | 76683951 |
| Molecular Formula | C19H18N2O4 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 2-benzyl-6-(3,4-dimethoxyphenoxy)pyridazin-3-one |
| SMILES | COc1ccc(Oc2ccc(=O)n(Cc3ccccc3)n2)cc1OC |
| InChI | InChI=1S/C19H18N2O4/c1-23-16-9-8-15(12-17(16)24-2)25-18-10-11-19(22)21(20-18)13-14-6-4-3-5-7-14/h3-12H,13H2,1-2H3 |
| InChIKey | WBGIUIPVASDTQM-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |