C17H28F2O — CID 76690731
2,3-difluoro-1-methyl-4-[3-(4-methylcyclohexyl)prop-2-enoxy]cyclohexane (PubChem CID 76690731) has the molecular formula C17H28F2O and a molecular weight of 286.41 g/mol. Its IUPAC name is 2,3-difluoro-1-methyl-4-[3-(4-methylcyclohexyl)prop-2-enoxy]cyclohexane.
| Compound Name | 2,3-difluoro-1-methyl-4-[3-(4-methylcyclohexyl)prop-2-enoxy]cyclohexane |
|---|---|
| PubChem CID | 76690731 |
| Molecular Formula | C17H28F2O |
| Molecular Weight | 286.41 g/mol |
| Exact Mass | 286.21 |
| IUPAC Name | 2,3-difluoro-1-methyl-4-[3-(4-methylcyclohexyl)prop-2-enoxy]cyclohexane |
| SMILES | CC1CCC(C=CCOC2CCC(C)C(F)C2F)CC1 |
| InChI | InChI=1S/C17H28F2O/c1-12-5-8-14(9-6-12)4-3-11-20-15-10-7-13(2)16(18)17(15)19/h3-4,12-17H,5-11H2,1-2H3 |
| InChIKey | WHMLKTBSAHVZAL-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.41 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|