C19H27N4O2+ — CID 76699896
2-[N-(2-hydroxyethyl)-4-[methyl-[1-(1-methylpyridin-1-ium-2-yl)ethylideneamino]amino]anilino]ethanol (PubChem CID 76699896) has the molecular formula C19H27N4O2+ and a molecular weight of 343.45 g/mol. Its IUPAC name is 2-[N-(2-hydroxyethyl)-4-[methyl-[1-(1-methylpyridin-1-ium-2-yl)ethylideneamino]amino]anilino]ethanol.
| Compound Name | 2-[N-(2-hydroxyethyl)-4-[methyl-[1-(1-methylpyridin-1-ium-2-yl)ethylideneamino]amino]anilino]ethanol |
|---|---|
| PubChem CID | 76699896 |
| Molecular Formula | C19H27N4O2+ |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | 2-[N-(2-hydroxyethyl)-4-[methyl-[1-(1-methylpyridin-1-ium-2-yl)ethylideneamino]amino]anilino]ethanol |
| SMILES | CC(=NN(C)c1ccc(N(CCO)CCO)cc1)c1cccc[n+]1C |
| InChI | InChI=1S/C19H27N4O2/c1-16(19-6-4-5-11-21(19)2)20-22(3)17-7-9-18(10-8-17)23(12-14-24)13-15-25/h4-11,24-25H,12-15H2,1-3H3/q+1 |
| InChIKey | LACJUMSGIZAQPE-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 63.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|