C23H29N4+ — CID 76699788
4-N,4-N-diethyl-1-N-methyl-1-N-[1-(1-methylquinolin-1-ium-2-yl)ethylideneamino]benzene-1,4-diamine (PubChem CID 76699788) has the molecular formula C23H29N4+ and a molecular weight of 361.51 g/mol. Its IUPAC name is 4-N,4-N-diethyl-1-N-methyl-1-N-[1-(1-methylquinolin-1-ium-2-yl)ethylideneamino]benzene-1,4-diamine.
| Compound Name | 4-N,4-N-diethyl-1-N-methyl-1-N-[1-(1-methylquinolin-1-ium-2-yl)ethylideneamino]benzene-1,4-diamine |
|---|---|
| PubChem CID | 76699788 |
| Molecular Formula | C23H29N4+ |
| Molecular Weight | 361.51 g/mol |
| Exact Mass | 361.24 |
| IUPAC Name | 4-N,4-N-diethyl-1-N-methyl-1-N-[1-(1-methylquinolin-1-ium-2-yl)ethylideneamino]benzene-1,4-diamine |
| SMILES | CCN(CC)c1ccc(N(C)N=C(C)c2ccc3ccccc3[n+]2C)cc1 |
| InChI | InChI=1S/C23H29N4/c1-6-27(7-2)21-15-13-20(14-16-21)26(5)24-18(3)22-17-12-19-10-8-9-11-23(19)25(22)4/h8-17H,6-7H2,1-5H3/q+1 |
| InChIKey | KNVUEUSGOPNBPR-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 22.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.51 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|