C23H27N4+ — CID 76699698
N-methyl-N-[1-(1-methylquinolin-1-ium-4-yl)ethylideneamino]-4-pyrrolidin-1-ylaniline (PubChem CID 76699698) has the molecular formula C23H27N4+ and a molecular weight of 359.50 g/mol. Its IUPAC name is N-methyl-N-[1-(1-methylquinolin-1-ium-4-yl)ethylideneamino]-4-pyrrolidin-1-ylaniline.
| Compound Name | N-methyl-N-[1-(1-methylquinolin-1-ium-4-yl)ethylideneamino]-4-pyrrolidin-1-ylaniline |
|---|---|
| PubChem CID | 76699698 |
| Molecular Formula | C23H27N4+ |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | N-methyl-N-[1-(1-methylquinolin-1-ium-4-yl)ethylideneamino]-4-pyrrolidin-1-ylaniline |
| SMILES | CC(=NN(C)c1ccc(N2CCCC2)cc1)c1cc[n+](C)c2ccccc12 |
| InChI | InChI=1S/C23H27N4/c1-18(21-14-17-25(2)23-9-5-4-8-22(21)23)24-26(3)19-10-12-20(13-11-19)27-15-6-7-16-27/h4-5,8-14,17H,6-7,15-16H2,1-3H3/q+1 |
| InChIKey | SKRQRHHJQYATQW-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 22.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|