C22H25N4+ — CID 76699816
N-methyl-N-[(1-methylquinolin-1-ium-4-yl)methylideneamino]-4-pyrrolidin-1-ylaniline (PubChem CID 76699816) has the molecular formula C22H25N4+ and a molecular weight of 345.47 g/mol. Its IUPAC name is N-methyl-N-[(1-methylquinolin-1-ium-4-yl)methylideneamino]-4-pyrrolidin-1-ylaniline.
| Compound Name | N-methyl-N-[(1-methylquinolin-1-ium-4-yl)methylideneamino]-4-pyrrolidin-1-ylaniline |
|---|---|
| PubChem CID | 76699816 |
| Molecular Formula | C22H25N4+ |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | N-methyl-N-[(1-methylquinolin-1-ium-4-yl)methylideneamino]-4-pyrrolidin-1-ylaniline |
| SMILES | CN(N=Cc1cc[n+](C)c2ccccc12)c1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C22H25N4/c1-24-16-13-18(21-7-3-4-8-22(21)24)17-23-25(2)19-9-11-20(12-10-19)26-14-5-6-15-26/h3-4,7-13,16-17H,5-6,14-15H2,1-2H3/q+1 |
| InChIKey | QZRYQKXOMLKLLJ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 22.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|