C14H19N2+ — CID 11551873
N,N-diethyl-1-methylquinolin-1-ium-7-amine (PubChem CID 11551873) has the molecular formula C14H19N2+ and a molecular weight of 215.32 g/mol. Its IUPAC name is N,N-diethyl-1-methylquinolin-1-ium-7-amine.
| Compound Name | N,N-diethyl-1-methylquinolin-1-ium-7-amine |
|---|---|
| PubChem CID | 11551873 |
| Molecular Formula | C14H19N2+ |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | N,N-diethyl-1-methylquinolin-1-ium-7-amine |
| SMILES | CCN(CC)c1ccc2ccc[n+](C)c2c1 |
| InChI | InChI=1S/C14H19N2/c1-4-16(5-2)13-9-8-12-7-6-10-15(3)14(12)11-13/h6-11H,4-5H2,1-3H3/q+1 |
| InChIKey | HDCAIZCXZKOIBS-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|