C17H19BF4N2 — CID 135005334
N,N-diethylbenzo[b]quinolizin-5-ium-9-amine tetrafluoroborate (PubChem CID 135005334) has the molecular formula C17H19BF4N2 and a molecular weight of 338.16 g/mol. Its IUPAC name is N,N-diethylbenzo[b]quinolizin-5-ium-9-amine tetrafluoroborate.
| Compound Name | N,N-diethylbenzo[b]quinolizin-5-ium-9-amine tetrafluoroborate |
|---|---|
| PubChem CID | 135005334 |
| Molecular Formula | C17H19BF4N2 |
| Molecular Weight | 338.16 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | N,N-diethylbenzo[b]quinolizin-5-ium-9-amine tetrafluoroborate |
| SMILES | CCN(CC)c1ccc2c[n+]3ccccc3cc2c1.F[B-](F)(F)F |
| InChI | InChI=1S/C17H19N2.BF4/c1-3-18(4-2)17-9-8-14-13-19-10-6-5-7-16(19)11-15(14)12-17;2-1(3,4)5/h5-13H,3-4H2,1-2H3;/q+1;-1 |
| InChIKey | YEGRWFHSHVAYDS-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 7.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.16 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_B(2)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|