C32H43N4+ — CID 144754130
9-[4-(diethylamino)phenyl]-3-N,3-N,6-N,6-N-tetraethyl-10-methylacridin-10-ium-3,6-diamine (PubChem CID 144754130) has the molecular formula C32H43N4+ and a molecular weight of 483.72 g/mol. Its IUPAC name is 9-[4-(diethylamino)phenyl]-3-N,3-N,6-N,6-N-tetraethyl-10-methylacridin-10-ium-3,6-diamine.
| Compound Name | 9-[4-(diethylamino)phenyl]-3-N,3-N,6-N,6-N-tetraethyl-10-methylacridin-10-ium-3,6-diamine |
|---|---|
| PubChem CID | 144754130 |
| Molecular Formula | C32H43N4+ |
| Molecular Weight | 483.72 g/mol |
| Exact Mass | 483.35 |
| IUPAC Name | 9-[4-(diethylamino)phenyl]-3-N,3-N,6-N,6-N-tetraethyl-10-methylacridin-10-ium-3,6-diamine |
| SMILES | CCN(CC)c1ccc(-c2c3ccc(N(CC)CC)cc3[n+](C)c3cc(N(CC)CC)ccc23)cc1 |
| InChI | InChI=1S/C32H43N4/c1-8-34(9-2)25-16-14-24(15-17-25)32-28-20-18-26(35(10-3)11-4)22-30(28)33(7)31-23-27(19-21-29(31)32)36(12-5)13-6/h14-23H,8-13H2,1-7H3/q+1 |
| InChIKey | NODGMCTXPBJAAA-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 13.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.72 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|