C26H40BN3O6 — CID 76700719
tert-butyl 2-[[1-amino-1-oxo-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propan-2-yl]carbamoyl]piperidine-1-carboxylate (PubChem CID 76700719) has the molecular formula C26H40BN3O6 and a molecular weight of 501.43 g/mol. Its IUPAC name is tert-butyl 2-[[1-amino-1-oxo-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propan-2-yl]carbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 2-[[1-amino-1-oxo-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propan-2-yl]carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 76700719 |
| Molecular Formula | C26H40BN3O6 |
| Molecular Weight | 501.43 g/mol |
| Exact Mass | 501.30 |
| IUPAC Name | tert-butyl 2-[[1-amino-1-oxo-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propan-2-yl]carbamoyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCCC1C(=O)NC(Cc1ccc(B2OC(C)(C)C(C)(C)O2)cc1)C(N)=O |
| InChI | InChI=1S/C26H40BN3O6/c1-24(2,3)34-23(33)30-15-9-8-10-20(30)22(32)29-19(21(28)31)16-17-11-13-18(14-12-17)27-35-25(4,5)26(6,7)36-27/h11-14,19-20H,8-10,15-16H2,1-7H3,(H2,28,31)(H,29,32) |
| InChIKey | ISTWNMQTJYFOOF-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 120.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.43 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|