C25H23FN4O3 — CID 76705799
1-[1-(4-fluorophenyl)ethyl]-3-[N-hydroxy-C-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]carbonimidoyl]pyridin-2-one (PubChem CID 76705799) has the molecular formula C25H23FN4O3 and a molecular weight of 446.48 g/mol. Its IUPAC name is 1-[1-(4-fluorophenyl)ethyl]-3-[N-hydroxy-C-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]carbonimidoyl]pyridin-2-one.
| Compound Name | 1-[1-(4-fluorophenyl)ethyl]-3-[N-hydroxy-C-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]carbonimidoyl]pyridin-2-one |
|---|---|
| PubChem CID | 76705799 |
| Molecular Formula | C25H23FN4O3 |
| Molecular Weight | 446.48 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | 1-[1-(4-fluorophenyl)ethyl]-3-[N-hydroxy-C-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]carbonimidoyl]pyridin-2-one |
| SMILES | COc1cc(C(=NO)c2cccn(C(C)c3ccc(F)cc3)c2=O)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C25H23FN4O3/c1-16-14-29(15-27-16)22-11-8-19(13-23(22)33-3)24(28-32)21-5-4-12-30(25(21)31)17(2)18-6-9-20(26)10-7-18/h4-15,17,32H,1-3H3 |
| InChIKey | NIZCBPZYCRPEMD-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 81.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.48 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|