C28H28FN5O4 — CID 88955380
1-(cyclopropylmethyl)-3-[1-(4-fluorophenyl)ethyl]-5-[(E)-N-hydroxy-C-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]carbonimidoyl]pyrimidine-2,4-dione (PubChem CID 88955380) has the molecular formula C28H28FN5O4 and a molecular weight of 517.56 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-3-[1-(4-fluorophenyl)ethyl]-5-[(E)-N-hydroxy-C-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]carbonimidoyl]pyrimidine-2,4-dione.
| Compound Name | 1-(cyclopropylmethyl)-3-[1-(4-fluorophenyl)ethyl]-5-[(E)-N-hydroxy-C-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]carbonimidoyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 88955380 |
| Molecular Formula | C28H28FN5O4 |
| Molecular Weight | 517.56 g/mol |
| Exact Mass | 517.21 |
| IUPAC Name | 1-(cyclopropylmethyl)-3-[1-(4-fluorophenyl)ethyl]-5-[(E)-N-hydroxy-C-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]carbonimidoyl]pyrimidine-2,4-dione |
| SMILES | COc1cc(/C(=N\O)c2cn(CC3CC3)c(=O)n(C(C)c3ccc(F)cc3)c2=O)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C28H28FN5O4/c1-17-13-33(16-30-17)24-11-8-21(12-25(24)38-3)26(31-37)23-15-32(14-19-4-5-19)28(36)34(27(23)35)18(2)20-6-9-22(29)10-7-20/h6-13,15-16,18-19,37H,4-5,14H2,1-3H3/b31-26+ |
| InChIKey | QMURPUOAYUERTC-GKPLWNPISA-N |
| XLogP | 3.90 |
| TPSA | 103.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.56 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|