C19H25N7O4 — CID 76721884
3-[[2-[(4-hydroxycyclohexyl)amino]-4-(2-methoxyethylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione (PubChem CID 76721884) has the molecular formula C19H25N7O4 and a molecular weight of 415.45 g/mol. Its IUPAC name is 3-[[2-[(4-hydroxycyclohexyl)amino]-4-(2-methoxyethylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione.
| Compound Name | 3-[[2-[(4-hydroxycyclohexyl)amino]-4-(2-methoxyethylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 76721884 |
| Molecular Formula | C19H25N7O4 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | 3-[[2-[(4-hydroxycyclohexyl)amino]-4-(2-methoxyethylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
| SMILES | COCCNc1nc(NC2CCC(O)CC2)nc2c(C=C3CC(=O)NC3=O)cnn12 |
| InChI | InChI=1S/C19H25N7O4/c1-30-7-6-20-19-25-18(22-13-2-4-14(27)5-3-13)24-16-12(10-21-26(16)19)8-11-9-15(28)23-17(11)29/h8,10,13-14,27H,2-7,9H2,1H3,(H,23,28,29)(H2,20,22,24,25) |
| InChIKey | GNQLZKCZSNZUQC-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 142.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|