C19H20FN3O3 — CID 76727666
N-[5-(5-fluoro-2-methoxyphenyl)-2-methyl-3,4-dihydro-1H-isoquinolin-8-yl]-2-hydroxyiminoacetamide (PubChem CID 76727666) has the molecular formula C19H20FN3O3 and a molecular weight of 357.39 g/mol. Its IUPAC name is N-[5-(5-fluoro-2-methoxyphenyl)-2-methyl-3,4-dihydro-1H-isoquinolin-8-yl]-2-hydroxyiminoacetamide.
| Compound Name | N-[5-(5-fluoro-2-methoxyphenyl)-2-methyl-3,4-dihydro-1H-isoquinolin-8-yl]-2-hydroxyiminoacetamide |
|---|---|
| PubChem CID | 76727666 |
| Molecular Formula | C19H20FN3O3 |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | N-[5-(5-fluoro-2-methoxyphenyl)-2-methyl-3,4-dihydro-1H-isoquinolin-8-yl]-2-hydroxyiminoacetamide |
| SMILES | COc1ccc(F)cc1-c1ccc(NC(=O)C=NO)c2c1CCN(C)C2 |
| InChI | InChI=1S/C19H20FN3O3/c1-23-8-7-14-13(15-9-12(20)3-6-18(15)26-2)4-5-17(16(14)11-23)22-19(24)10-21-25/h3-6,9-10,25H,7-8,11H2,1-2H3,(H,22,24) |
| InChIKey | MOOBZYSLCIYPIO-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|