C20H20FN3O2 — CID 163971216
3-(5-fluoro-2-methoxyphenyl)-6-methyl-1a,4,5,7,8,9a-hexahydro-1H-azirino[2,3-c][1,9]phenanthrolin-9-one (PubChem CID 163971216) has the molecular formula C20H20FN3O2 and a molecular weight of 353.40 g/mol. Its IUPAC name is 3-(5-fluoro-2-methoxyphenyl)-6-methyl-1a,4,5,7,8,9a-hexahydro-1H-azirino[2,3-c][1,9]phenanthrolin-9-one.
| Compound Name | 3-(5-fluoro-2-methoxyphenyl)-6-methyl-1a,4,5,7,8,9a-hexahydro-1H-azirino[2,3-c][1,9]phenanthrolin-9-one |
|---|---|
| PubChem CID | 163971216 |
| Molecular Formula | C20H20FN3O2 |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | 3-(5-fluoro-2-methoxyphenyl)-6-methyl-1a,4,5,7,8,9a-hexahydro-1H-azirino[2,3-c][1,9]phenanthrolin-9-one |
| SMILES | COc1ccc(F)cc1-c1cc2c(c3c1CCN(C)C3)NC(=O)C1NC21 |
| InChI | InChI=1S/C20H20FN3O2/c1-24-6-5-11-12(13-7-10(21)3-4-16(13)26-2)8-14-17(15(11)9-24)23-20(25)19-18(14)22-19/h3-4,7-8,18-19,22H,5-6,9H2,1-2H3,(H,23,25) |
| InChIKey | SQDPJBPOCUELDD-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 63.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|