C18H12F3NO3S — CID 7673157
methyl 2-[[3-(trifluoromethyl)benzoyl]amino]-1-benzothiophene-3-carboxylate (PubChem CID 7673157) has the molecular formula C18H12F3NO3S and a molecular weight of 379.36 g/mol. Its IUPAC name is methyl 2-[[3-(trifluoromethyl)benzoyl]amino]-1-benzothiophene-3-carboxylate.
| Compound Name | methyl 2-[[3-(trifluoromethyl)benzoyl]amino]-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 7673157 |
| Molecular Formula | C18H12F3NO3S |
| Molecular Weight | 379.36 g/mol |
| Exact Mass | 379.05 |
| IUPAC Name | methyl 2-[[3-(trifluoromethyl)benzoyl]amino]-1-benzothiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)c2cccc(C(F)(F)F)c2)sc2ccccc12 |
| InChI | InChI=1S/C18H12F3NO3S/c1-25-17(24)14-12-7-2-3-8-13(12)26-16(14)22-15(23)10-5-4-6-11(9-10)18(19,20)21/h2-9H,1H3,(H,22,23) |
| InChIKey | DWPVVFYYNUXCHN-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.36 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |