C20H21FN4 — CID 767373
2-N,4-N-bis(2,4-dimethylphenyl)-5-fluoropyrimidine-2,4-diamine (PubChem CID 767373) has the molecular formula C20H21FN4 and a molecular weight of 336.41 g/mol. Its IUPAC name is 2-N,4-N-bis(2,4-dimethylphenyl)-5-fluoropyrimidine-2,4-diamine.
| Compound Name | 2-N,4-N-bis(2,4-dimethylphenyl)-5-fluoropyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 767373 |
| Molecular Formula | C20H21FN4 |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 2-N,4-N-bis(2,4-dimethylphenyl)-5-fluoropyrimidine-2,4-diamine |
| SMILES | Cc1ccc(Nc2ncc(F)c(Nc3ccc(C)cc3C)n2)c(C)c1 |
| InChI | InChI=1S/C20H21FN4/c1-12-5-7-17(14(3)9-12)23-19-16(21)11-22-20(25-19)24-18-8-6-13(2)10-15(18)4/h5-11H,1-4H3,(H2,22,23,24,25) |
| InChIKey | RKCSEXIHMPENAW-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |