C22H22ClF2N5O2S — CID 76750708
N-[[2-[4-[(2-chloro-4,4-difluorospiro[5H-thieno[2,3-c]pyran-7,4'-piperidine]-1'-yl)methyl]-3-methylpyrazol-1-yl]-3-pyridinyl]methylidene]hydroxylamine (PubChem CID 76750708) has the molecular formula C22H22ClF2N5O2S and a molecular weight of 493.97 g/mol. Its IUPAC name is N-[[2-[4-[(2-chloro-4,4-difluorospiro[5H-thieno[2,3-c]pyran-7,4'-piperidine]-1'-yl)methyl]-3-methylpyrazol-1-yl]-3-pyridinyl]methylidene]hydroxylamine.
| Compound Name | N-[[2-[4-[(2-chloro-4,4-difluorospiro[5H-thieno[2,3-c]pyran-7,4'-piperidine]-1'-yl)methyl]-3-methylpyrazol-1-yl]-3-pyridinyl]methylidene]hydroxylamine |
|---|---|
| PubChem CID | 76750708 |
| Molecular Formula | C22H22ClF2N5O2S |
| Molecular Weight | 493.97 g/mol |
| Exact Mass | 493.12 |
| IUPAC Name | N-[[2-[4-[(2-chloro-4,4-difluorospiro[5H-thieno[2,3-c]pyran-7,4'-piperidine]-1'-yl)methyl]-3-methylpyrazol-1-yl]-3-pyridinyl]methylidene]hydroxylamine |
| SMILES | Cc1nn(-c2ncccc2C=NO)cc1CN1CCC2(CC1)OCC(F)(F)c1cc(Cl)sc12 |
| InChI | InChI=1S/C22H22ClF2N5O2S/c1-14-16(12-30(28-14)20-15(10-27-31)3-2-6-26-20)11-29-7-4-21(5-8-29)19-17(9-18(23)33-19)22(24,25)13-32-21/h2-3,6,9-10,12,31H,4-5,7-8,11,13H2,1H3 |
| InChIKey | OWLJCHWQDDNUGR-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 75.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.97 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|