C26H27ClF3N3O3S — CID 162589097
ethyl 4-[(2-chloro-4,4-difluorospiro[5H-thieno[2,3-c]pyran-7,4'-piperidine]-1'-yl)methyl]-1-(2-fluorocycloocta-1,3,5-trien-1-yl)pyrazole-3-carboxylate (PubChem CID 162589097) has the molecular formula C26H27ClF3N3O3S and a molecular weight of 554.03 g/mol. Its IUPAC name is ethyl 4-[(2-chloro-4,4-difluorospiro[5H-thieno[2,3-c]pyran-7,4'-piperidine]-1'-yl)methyl]-1-(2-fluorocycloocta-1,3,5-trien-1-yl)pyrazole-3-carboxylate.
| Compound Name | ethyl 4-[(2-chloro-4,4-difluorospiro[5H-thieno[2,3-c]pyran-7,4'-piperidine]-1'-yl)methyl]-1-(2-fluorocycloocta-1,3,5-trien-1-yl)pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 162589097 |
| Molecular Formula | C26H27ClF3N3O3S |
| Molecular Weight | 554.03 g/mol |
| Exact Mass | 553.14 |
| IUPAC Name | ethyl 4-[(2-chloro-4,4-difluorospiro[5H-thieno[2,3-c]pyran-7,4'-piperidine]-1'-yl)methyl]-1-(2-fluorocycloocta-1,3,5-trien-1-yl)pyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1nn(C2=C(F)C=CC=CCC2)cc1CN1CCC2(CC1)OCC(F)(F)c1cc(Cl)sc12 |
| InChI | InChI=1S/C26H27ClF3N3O3S/c1-2-35-24(34)22-17(15-33(31-22)20-8-6-4-3-5-7-19(20)28)14-32-11-9-25(10-12-32)23-18(13-21(27)37-23)26(29,30)16-36-25/h3-5,7,13,15H,2,6,8-12,14,16H2,1H3 |
| InChIKey | XMWWUKWUYIPDLN-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.03 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |