C19H25ClF2N4O2S — CID 164726090
(2R)-4-[4-[(2'S,6'S)-2-chloro-4,4-difluoro-6'-methylspiro[5H-thieno[2,3-c]pyran-7,4'-piperidine]-2'-yl]triazol-1-yl]-2-methylbutan-1-ol (PubChem CID 164726090) has the molecular formula C19H25ClF2N4O2S and a molecular weight of 446.95 g/mol. Its IUPAC name is (2R)-4-[4-[(2'S,6'S)-2-chloro-4,4-difluoro-6'-methylspiro[5H-thieno[2,3-c]pyran-7,4'-piperidine]-2'-yl]triazol-1-yl]-2-methylbutan-1-ol.
| Compound Name | (2R)-4-[4-[(2'S,6'S)-2-chloro-4,4-difluoro-6'-methylspiro[5H-thieno[2,3-c]pyran-7,4'-piperidine]-2'-yl]triazol-1-yl]-2-methylbutan-1-ol |
|---|---|
| PubChem CID | 164726090 |
| Molecular Formula | C19H25ClF2N4O2S |
| Molecular Weight | 446.95 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | (2R)-4-[4-[(2'S,6'S)-2-chloro-4,4-difluoro-6'-methylspiro[5H-thieno[2,3-c]pyran-7,4'-piperidine]-2'-yl]triazol-1-yl]-2-methylbutan-1-ol |
| SMILES | C[C@@H](CO)CCn1cc([C@@H]2CC3(C[C@H](C)N2)OCC(F)(F)c2cc(Cl)sc23)nn1 |
| InChI | InChI=1S/C19H25ClF2N4O2S/c1-11(9-27)3-4-26-8-15(24-25-26)14-7-18(6-12(2)23-14)17-13(5-16(20)29-17)19(21,22)10-28-18/h5,8,11-12,14,23,27H,3-4,6-7,9-10H2,1-2H3/t11-,12+,14+,18?/m1/s1 |
| InChIKey | ODKOINUMKRLOKA-NTCSTIOSSA-N |
| XLogP | 3.84 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.95 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |