C22H25ClN4O3S — CID 175725299
2-chloro-2'-[1-[[4-(hydroxymethyl)phenyl]methyl]triazol-4-yl]-6'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-4-ol (PubChem CID 175725299) has the molecular formula C22H25ClN4O3S and a molecular weight of 460.99 g/mol. Its IUPAC name is 2-chloro-2'-[1-[[4-(hydroxymethyl)phenyl]methyl]triazol-4-yl]-6'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-4-ol.
| Compound Name | 2-chloro-2'-[1-[[4-(hydroxymethyl)phenyl]methyl]triazol-4-yl]-6'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-4-ol |
|---|---|
| PubChem CID | 175725299 |
| Molecular Formula | C22H25ClN4O3S |
| Molecular Weight | 460.99 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | 2-chloro-2'-[1-[[4-(hydroxymethyl)phenyl]methyl]triazol-4-yl]-6'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine]-4-ol |
| SMILES | CC1CC2(CC(c3cn(Cc4ccc(CO)cc4)nn3)N1)OCC(O)c1cc(Cl)sc12 |
| InChI | InChI=1S/C22H25ClN4O3S/c1-13-7-22(21-16(6-20(23)31-21)19(29)12-30-22)8-17(24-13)18-10-27(26-25-18)9-14-2-4-15(11-28)5-3-14/h2-6,10,13,17,19,24,28-29H,7-9,11-12H2,1H3 |
| InChIKey | XUDYBWSJXISGBO-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.99 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |